C27H30F8N2O5 — CID 22232614
2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-(5,5,6,6,7,7,7-heptafluoroheptyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22232614) has the molecular formula C27H30F8N2O5 and a molecular weight of 614.53 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-(5,5,6,6,7,7,7-heptafluoroheptyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-(5,5,6,6,7,7,7-heptafluoroheptyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232614 |
| Molecular Formula | C27H30F8N2O5 |
| Molecular Weight | 614.53 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-(5,5,6,6,7,7,7-heptafluoroheptyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC(F)(F)C(F)(F)C(F)(F)F)C(=O)Nc2ccccc2F)cc1)C(=O)O |
| InChI | InChI=1S/C27H30F8N2O5/c1-2-41-22(23(38)39)17-18-9-11-19(12-10-18)42-16-15-37(24(40)36-21-8-4-3-7-20(21)28)14-6-5-13-25(29,30)26(31,32)27(33,34)35/h3-4,7-12,22H,2,5-6,13-17H2,1H3,(H,36,40)(H,38,39) |
| InChIKey | FLHRGCZIQOWPJE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.53 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|