C27H34F4N2O5 — CID 22231688
2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231688) has the molecular formula C27H34F4N2O5 and a molecular weight of 542.57 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231688 |
| Molecular Formula | C27H34F4N2O5 |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(2-fluorophenyl)carbamoyl-(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCCC(F)(F)F)C(=O)Nc2ccccc2F)cc1)C(=O)O |
| InChI | InChI=1S/C27H34F4N2O5/c1-2-37-24(25(34)35)19-20-11-13-21(14-12-20)38-18-17-33(16-8-4-3-7-15-27(29,30)31)26(36)32-23-10-6-5-9-22(23)28/h5-6,9-14,24H,2-4,7-8,15-19H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | ALMMUZWIORHDQO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|