C25H31F3N2O6 — CID 22231636
2-ethoxy-3-[4-[2-[3-phenoxypropyl(2,2,2-trifluoroethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231636) has the molecular formula C25H31F3N2O6 and a molecular weight of 512.53 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-phenoxypropyl(2,2,2-trifluoroethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-phenoxypropyl(2,2,2-trifluoroethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231636 |
| Molecular Formula | C25H31F3N2O6 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-phenoxypropyl(2,2,2-trifluoroethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOc2ccccc2)C(=O)NCC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C25H31F3N2O6/c1-2-34-22(23(31)32)17-19-9-11-21(12-10-19)36-16-14-30(24(33)29-18-25(26,27)28)13-6-15-35-20-7-4-3-5-8-20/h3-5,7-12,22H,2,6,13-18H2,1H3,(H,29,33)(H,31,32) |
| InChIKey | BGRVWEZBFVFHRG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|