C25H38F3NO6 — CID 22229876
3-[4-[2-[butan-2-yloxycarbonyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22229876) has the molecular formula C25H38F3NO6 and a molecular weight of 505.57 g/mol. Its IUPAC name is 3-[4-[2-[butan-2-yloxycarbonyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[butan-2-yloxycarbonyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22229876 |
| Molecular Formula | C25H38F3NO6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 3-[4-[2-[butan-2-yloxycarbonyl(7,7,7-trifluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCCCC(F)(F)F)C(=O)OC(C)CC)cc1)C(=O)O |
| InChI | InChI=1S/C25H38F3NO6/c1-4-19(3)35-24(32)29(15-9-7-6-8-14-25(26,27)28)16-17-34-21-12-10-20(11-13-21)18-22(23(30)31)33-5-2/h10-13,19,22H,4-9,14-18H2,1-3H3,(H,30,31) |
| InChIKey | GCLWDVYZDPCUBV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|