C27H36N2O5 — CID 22230233
3-[4-[2-[benzylcarbamoyl(cyclopentylmethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230233) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is 3-[4-[2-[benzylcarbamoyl(cyclopentylmethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[benzylcarbamoyl(cyclopentylmethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230233 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 3-[4-[2-[benzylcarbamoyl(cyclopentylmethyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC2CCCC2)C(=O)NCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H36N2O5/c1-2-33-25(26(30)31)18-21-12-14-24(15-13-21)34-17-16-29(20-23-10-6-7-11-23)27(32)28-19-22-8-4-3-5-9-22/h3-5,8-9,12-15,23,25H,2,6-7,10-11,16-20H2,1H3,(H,28,32)(H,30,31) |
| InChIKey | OUHHBOBCYAKOCT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |