C26H30F13NO6 — CID 22233638
3-[4-[2-[2,2-dimethylpropoxycarbonyl(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22233638) has the molecular formula C26H30F13NO6 and a molecular weight of 699.50 g/mol. Its IUPAC name is 3-[4-[2-[2,2-dimethylpropoxycarbonyl(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2,2-dimethylpropoxycarbonyl(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22233638 |
| Molecular Formula | C26H30F13NO6 |
| Molecular Weight | 699.50 g/mol |
| Exact Mass | 699.19 |
| IUPAC Name | 3-[4-[2-[2,2-dimethylpropoxycarbonyl(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C26H30F13NO6/c1-5-44-17(18(41)42)12-15-6-8-16(9-7-15)45-11-10-40(19(43)46-14-20(2,3)4)13-21(27,28)22(29,30)23(31,32)24(33,34)25(35,36)26(37,38)39/h6-9,17H,5,10-14H2,1-4H3,(H,41,42) |
| InChIKey | AMDNEIZVFHGIJZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.50 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|