C25H25F8NO7 — CID 22233698
2-ethoxy-3-[4-[2-[(2-fluorophenoxy)carbonyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233698) has the molecular formula C25H25F8NO7 and a molecular weight of 603.46 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(2-fluorophenoxy)carbonyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(2-fluorophenoxy)carbonyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233698 |
| Molecular Formula | C25H25F8NO7 |
| Molecular Weight | 603.46 g/mol |
| Exact Mass | 603.15 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(2-fluorophenoxy)carbonyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOC(F)(F)C(F)(F)C(F)(F)F)C(=O)Oc2ccccc2F)cc1)C(=O)O |
| InChI | InChI=1S/C25H25F8NO7/c1-2-38-20(21(35)36)15-16-7-9-17(10-8-16)39-13-11-34(22(37)41-19-6-4-3-5-18(19)26)12-14-40-25(32,33)23(27,28)24(29,30)31/h3-10,20H,2,11-15H2,1H3,(H,35,36) |
| InChIKey | XGKNHPIECHGFAA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|