C25H26F8N2O6 — CID 22230852
2-ethoxy-3-[4-[2-[(3-fluorophenyl)carbamoyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230852) has the molecular formula C25H26F8N2O6 and a molecular weight of 602.48 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(3-fluorophenyl)carbamoyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(3-fluorophenyl)carbamoyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230852 |
| Molecular Formula | C25H26F8N2O6 |
| Molecular Weight | 602.48 g/mol |
| Exact Mass | 602.17 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(3-fluorophenyl)carbamoyl-[2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOC(F)(F)C(F)(F)C(F)(F)F)C(=O)Nc2cccc(F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C25H26F8N2O6/c1-2-39-20(21(36)37)14-16-6-8-19(9-7-16)40-12-10-35(22(38)34-18-5-3-4-17(26)15-18)11-13-41-25(32,33)23(27,28)24(29,30)31/h3-9,15,20H,2,10-14H2,1H3,(H,34,38)(H,36,37) |
| InChIKey | RVJFOXJKYFNRIB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|