C27H26F11NO7 — CID 22230303
3-[4-[2-[(2,4-difluorophenyl)methoxycarbonyl-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22230303) has the molecular formula C27H26F11NO7 and a molecular weight of 685.48 g/mol. Its IUPAC name is 3-[4-[2-[(2,4-difluorophenyl)methoxycarbonyl-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(2,4-difluorophenyl)methoxycarbonyl-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22230303 |
| Molecular Formula | C27H26F11NO7 |
| Molecular Weight | 685.48 g/mol |
| Exact Mass | 685.15 |
| IUPAC Name | 3-[4-[2-[(2,4-difluorophenyl)methoxycarbonyl-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCc2ccc(F)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C27H26F11NO7/c1-2-43-21(22(40)41)13-16-3-7-19(8-4-16)44-11-9-39(23(42)45-15-17-5-6-18(28)14-20(17)29)10-12-46-27(37,38)25(32,33)24(30,31)26(34,35)36/h3-8,14,21H,2,9-13,15H2,1H3,(H,40,41) |
| InChIKey | LIEBADKZDXTPSX-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|