C31H34F3NO7 — CID 22231511
3-[4-[2-[(2,4-difluorophenyl)methoxycarbonyl-[4-(4-fluorophenoxy)butyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231511) has the molecular formula C31H34F3NO7 and a molecular weight of 589.61 g/mol. Its IUPAC name is 3-[4-[2-[(2,4-difluorophenyl)methoxycarbonyl-[4-(4-fluorophenoxy)butyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(2,4-difluorophenyl)methoxycarbonyl-[4-(4-fluorophenoxy)butyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231511 |
| Molecular Formula | C31H34F3NO7 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 3-[4-[2-[(2,4-difluorophenyl)methoxycarbonyl-[4-(4-fluorophenoxy)butyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCOc2ccc(F)cc2)C(=O)OCc2ccc(F)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C31H34F3NO7/c1-2-39-29(30(36)37)19-22-5-11-26(12-6-22)41-18-16-35(15-3-4-17-40-27-13-9-24(32)10-14-27)31(38)42-21-23-7-8-25(33)20-28(23)34/h5-14,20,29H,2-4,15-19,21H2,1H3,(H,36,37) |
| InChIKey | JGQGLGPCGONIHO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|