C31H41F2NO6 — CID 22232891
3-[4-[2-[4-cyclohexylbutyl-[(2,4-difluorophenyl)methoxycarbonyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232891) has the molecular formula C31H41F2NO6 and a molecular weight of 561.67 g/mol. Its IUPAC name is 3-[4-[2-[4-cyclohexylbutyl-[(2,4-difluorophenyl)methoxycarbonyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-cyclohexylbutyl-[(2,4-difluorophenyl)methoxycarbonyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232891 |
| Molecular Formula | C31H41F2NO6 |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | 3-[4-[2-[4-cyclohexylbutyl-[(2,4-difluorophenyl)methoxycarbonyl]amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC2CCCCC2)C(=O)OCc2ccc(F)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C31H41F2NO6/c1-2-38-29(30(35)36)20-24-11-15-27(16-12-24)39-19-18-34(17-7-6-10-23-8-4-3-5-9-23)31(37)40-22-25-13-14-26(32)21-28(25)33/h11-16,21,23,29H,2-10,17-20,22H2,1H3,(H,35,36) |
| InChIKey | DNIYHTONOBMIDQ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|