C33H45NO6 — CID 22234561
3-[4-[2-[4-cyclohexylbutyl(2,3-dihydro-1H-inden-5-yloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234561) has the molecular formula C33H45NO6 and a molecular weight of 551.72 g/mol. Its IUPAC name is 3-[4-[2-[4-cyclohexylbutyl(2,3-dihydro-1H-inden-5-yloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[4-cyclohexylbutyl(2,3-dihydro-1H-inden-5-yloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234561 |
| Molecular Formula | C33H45NO6 |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | 3-[4-[2-[4-cyclohexylbutyl(2,3-dihydro-1H-inden-5-yloxycarbonyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC2CCCCC2)C(=O)Oc2ccc3c(c2)CCC3)cc1)C(=O)O |
| InChI | InChI=1S/C33H45NO6/c1-2-38-31(32(35)36)23-26-14-17-29(18-15-26)39-22-21-34(20-7-6-11-25-9-4-3-5-10-25)33(37)40-30-19-16-27-12-8-13-28(27)24-30/h14-19,24-25,31H,2-13,20-23H2,1H3,(H,35,36) |
| InChIKey | CTQDZRKLXOQCTH-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|