C30H40ClNO6 — CID 22229515
3-[4-[2-[(4-chlorophenoxy)carbonyl-(4-cyclohexylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22229515) has the molecular formula C30H40ClNO6 and a molecular weight of 546.10 g/mol. Its IUPAC name is 3-[4-[2-[(4-chlorophenoxy)carbonyl-(4-cyclohexylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[(4-chlorophenoxy)carbonyl-(4-cyclohexylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22229515 |
| Molecular Formula | C30H40ClNO6 |
| Molecular Weight | 546.10 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | 3-[4-[2-[(4-chlorophenoxy)carbonyl-(4-cyclohexylbutyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCCC2CCCCC2)C(=O)Oc2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C30H40ClNO6/c1-2-36-28(29(33)34)22-24-11-15-26(16-12-24)37-21-20-32(19-7-6-10-23-8-4-3-5-9-23)30(35)38-27-17-13-25(31)14-18-27/h11-18,23,28H,2-10,19-22H2,1H3,(H,33,34) |
| InChIKey | CRLNOMROZYIOGL-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.10 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|