C33H39NO7 — CID 22234381
3-[4-[2-[2,3-dihydro-1H-inden-5-yloxycarbonyl(3-phenylmethoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22234381) has the molecular formula C33H39NO7 and a molecular weight of 561.68 g/mol. Its IUPAC name is 3-[4-[2-[2,3-dihydro-1H-inden-5-yloxycarbonyl(3-phenylmethoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2,3-dihydro-1H-inden-5-yloxycarbonyl(3-phenylmethoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22234381 |
| Molecular Formula | C33H39NO7 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | 3-[4-[2-[2,3-dihydro-1H-inden-5-yloxycarbonyl(3-phenylmethoxypropyl)amino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccccc2)C(=O)Oc2ccc3c(c2)CCC3)cc1)C(=O)O |
| InChI | InChI=1S/C33H39NO7/c1-2-39-31(32(35)36)22-25-12-15-29(16-13-25)40-21-19-34(18-7-20-38-24-26-8-4-3-5-9-26)33(37)41-30-17-14-27-10-6-11-28(27)23-30/h3-5,8-9,12-17,23,31H,2,6-7,10-11,18-22,24H2,1H3,(H,35,36) |
| InChIKey | DKMPKSCKJBQULL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|