C33H41NO7 — CID 22231049
2-ethoxy-3-[4-[2-[3-phenylmethoxypropyl-(2,4,6-trimethylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22231049) has the molecular formula C33H41NO7 and a molecular weight of 563.69 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-phenylmethoxypropyl-(2,4,6-trimethylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-phenylmethoxypropyl-(2,4,6-trimethylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231049 |
| Molecular Formula | C33H41NO7 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-phenylmethoxypropyl-(2,4,6-trimethylphenoxy)carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccccc2)C(=O)Oc2c(C)cc(C)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C33H41NO7/c1-5-39-30(32(35)36)22-27-12-14-29(15-13-27)40-19-17-34(16-9-18-38-23-28-10-7-6-8-11-28)33(37)41-31-25(3)20-24(2)21-26(31)4/h6-8,10-15,20-21,30H,5,9,16-19,22-23H2,1-4H3,(H,35,36) |
| InChIKey | LZYYPWQMLJWUOM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|