C30H32F3NO7 — CID 22232019
2-ethoxy-3-[4-[2-[3-phenoxypropyl-[2-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22232019) has the molecular formula C30H32F3NO7 and a molecular weight of 575.58 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-phenoxypropyl-[2-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-phenoxypropyl-[2-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22232019 |
| Molecular Formula | C30H32F3NO7 |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-phenoxypropyl-[2-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOc2ccccc2)C(=O)Oc2ccccc2C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C30H32F3NO7/c1-2-38-27(28(35)36)21-22-13-15-24(16-14-22)40-20-18-34(17-8-19-39-23-9-4-3-5-10-23)29(37)41-26-12-7-6-11-25(26)30(31,32)33/h3-7,9-16,27H,2,8,17-21H2,1H3,(H,35,36) |
| InChIKey | WECBCMTYIZCYKF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|