C26H32F3NO6 — CID 22229993
2-ethoxy-3-[4-[2-[pentyl-[2-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid (PubChem CID 22229993) has the molecular formula C26H32F3NO6 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[pentyl-[2-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[pentyl-[2-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22229993 |
| Molecular Formula | C26H32F3NO6 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[pentyl-[2-(trifluoromethyl)phenoxy]carbonylamino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCCCN(CCOc1ccc(CC(OCC)C(=O)O)cc1)C(=O)Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C26H32F3NO6/c1-3-5-8-15-30(25(33)36-22-10-7-6-9-21(22)26(27,28)29)16-17-35-20-13-11-19(12-14-20)18-23(24(31)32)34-4-2/h6-7,9-14,23H,3-5,8,15-18H2,1-2H3,(H,31,32) |
| InChIKey | TVIQDFOPXNSFCK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|