C28H37F2NO7 — CID 22232183
3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(2,4,5-trimethylphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232183) has the molecular formula C28H37F2NO7 and a molecular weight of 537.60 g/mol. Its IUPAC name is 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(2,4,5-trimethylphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(2,4,5-trimethylphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232183 |
| Molecular Formula | C28H37F2NO7 |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(2,4,5-trimethylphenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCC(C)(F)F)C(=O)Oc2cc(C)c(C)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C28H37F2NO7/c1-6-36-25(26(32)33)17-22-7-9-23(10-8-22)37-14-12-31(11-13-35-18-28(5,29)30)27(34)38-24-16-20(3)19(2)15-21(24)4/h7-10,15-16,25H,6,11-14,17-18H2,1-5H3,(H,32,33) |
| InChIKey | AXBKYMCMNFPNKD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|