C26H32F2N2O9 — CID 22232776
3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(4-methyl-3-nitrophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22232776) has the molecular formula C26H32F2N2O9 and a molecular weight of 554.54 g/mol. Its IUPAC name is 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(4-methyl-3-nitrophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(4-methyl-3-nitrophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22232776 |
| Molecular Formula | C26H32F2N2O9 |
| Molecular Weight | 554.54 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 3-[4-[2-[2-(2,2-difluoropropoxy)ethyl-(4-methyl-3-nitrophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCOCC(C)(F)F)C(=O)Oc2ccc(C)c([N+](=O)[O-])c2)cc1)C(=O)O |
| InChI | InChI=1S/C26H32F2N2O9/c1-4-37-23(24(31)32)15-19-6-9-20(10-7-19)38-14-12-29(11-13-36-17-26(3,27)28)25(33)39-21-8-5-18(2)22(16-21)30(34)35/h5-10,16,23H,4,11-15,17H2,1-3H3,(H,31,32) |
| InChIKey | BPZDWTCWAOWDGY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|