C25H30N2O8 — CID 22231930
3-[4-[2-[cyclopropylmethyl-(4-methyl-3-nitrophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 22231930) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is 3-[4-[2-[cyclopropylmethyl-(4-methyl-3-nitrophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-[cyclopropylmethyl-(4-methyl-3-nitrophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 22231930 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 3-[4-[2-[cyclopropylmethyl-(4-methyl-3-nitrophenoxy)carbonylamino]ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC2CC2)C(=O)Oc2ccc(C)c([N+](=O)[O-])c2)cc1)C(=O)O |
| InChI | InChI=1S/C25H30N2O8/c1-3-33-23(24(28)29)14-18-7-10-20(11-8-18)34-13-12-26(16-19-5-6-19)25(30)35-21-9-4-17(2)22(15-21)27(31)32/h4,7-11,15,19,23H,3,5-6,12-14,16H2,1-2H3,(H,28,29) |
| InChIKey | GKTFEKIMOHCPMM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|