C32H40N2O7 — CID 22231403
2-ethoxy-3-[4-[2-[(2-methoxy-5-methylphenyl)carbamoyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231403) has the molecular formula C32H40N2O7 and a molecular weight of 564.68 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[(2-methoxy-5-methylphenyl)carbamoyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[(2-methoxy-5-methylphenyl)carbamoyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231403 |
| Molecular Formula | C32H40N2O7 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[(2-methoxy-5-methylphenyl)carbamoyl-(3-phenylmethoxypropyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccccc2)C(=O)Nc2cc(C)ccc2OC)cc1)C(=O)O |
| InChI | InChI=1S/C32H40N2O7/c1-4-40-30(31(35)36)22-25-12-14-27(15-13-25)41-20-18-34(17-8-19-39-23-26-9-6-5-7-10-26)32(37)33-28-21-24(2)11-16-29(28)38-3/h5-7,9-16,21,30H,4,8,17-20,22-23H2,1-3H3,(H,33,37)(H,35,36) |
| InChIKey | DSGDEYPXHHWKJX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|