C31H37FN2O6 — CID 22230975
2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-[(3-methylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 22230975) has the molecular formula C31H37FN2O6 and a molecular weight of 552.64 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-[(3-methylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-[(3-methylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22230975 |
| Molecular Formula | C31H37FN2O6 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[3-[(4-fluorophenyl)methoxy]propyl-[(3-methylphenyl)carbamoyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CCCOCc2ccc(F)cc2)C(=O)Nc2cccc(C)c2)cc1)C(=O)O |
| InChI | InChI=1S/C31H37FN2O6/c1-3-39-29(30(35)36)21-24-10-14-28(15-11-24)40-19-17-34(31(37)33-27-7-4-6-23(2)20-27)16-5-18-38-22-25-8-12-26(32)13-9-25/h4,6-15,20,29H,3,5,16-19,21-22H2,1-2H3,(H,33,37)(H,35,36) |
| InChIKey | BKZCRHTYMBQFHS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|