C24H35NO6 — CID 22229980
2-ethoxy-3-[4-[2-[heptyl(prop-2-ynoxycarbonyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22229980) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[heptyl(prop-2-ynoxycarbonyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[heptyl(prop-2-ynoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22229980 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[heptyl(prop-2-ynoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | C#CCOC(=O)N(CCCCCCC)CCOc1ccc(CC(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C24H35NO6/c1-4-7-8-9-10-15-25(24(28)31-17-5-2)16-18-30-21-13-11-20(12-14-21)19-22(23(26)27)29-6-3/h2,11-14,22H,4,6-10,15-19H2,1,3H3,(H,26,27) |
| InChIKey | OSTKQHHIEWVAID-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|