C22H36N2O5 — CID 22233136
2-ethoxy-3-[4-[2-[2-ethylbutyl(ethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22233136) has the molecular formula C22H36N2O5 and a molecular weight of 408.54 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-ethylbutyl(ethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-ethylbutyl(ethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22233136 |
| Molecular Formula | C22H36N2O5 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-ethylbutyl(ethylcarbamoyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCNC(=O)N(CCOc1ccc(CC(OCC)C(=O)O)cc1)CC(CC)CC |
| InChI | InChI=1S/C22H36N2O5/c1-5-17(6-2)16-24(22(27)23-7-3)13-14-29-19-11-9-18(10-12-19)15-20(21(25)26)28-8-4/h9-12,17,20H,5-8,13-16H2,1-4H3,(H,23,27)(H,25,26) |
| InChIKey | CZUCIOZCDOVJCR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |