C28H39NO6 — CID 22231002
2-ethoxy-3-[4-[2-[2-ethylbutyl(2-phenylethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 22231002) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-ethylbutyl(2-phenylethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-ethylbutyl(2-phenylethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22231002 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-ethylbutyl(2-phenylethoxycarbonyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCN(CC(CC)CC)C(=O)OCCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H39NO6/c1-4-22(5-2)21-29(28(32)35-18-16-23-10-8-7-9-11-23)17-19-34-25-14-12-24(13-15-25)20-26(27(30)31)33-6-3/h7-15,22,26H,4-6,16-21H2,1-3H3,(H,30,31) |
| InChIKey | VCFHAVNQQHGIEG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |