C19H12ClF26NS — CID 102384011
N,N-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)carbamothioyl chloride (PubChem CID 102384011) has the molecular formula C19H12ClF26NS and a molecular weight of 815.78 g/mol. Its IUPAC name is N,N-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)carbamothioyl chloride.
| Compound Name | N,N-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)carbamothioyl chloride |
|---|---|
| PubChem CID | 102384011 |
| Molecular Formula | C19H12ClF26NS |
| Molecular Weight | 815.78 g/mol |
| Exact Mass | 815.00 |
| IUPAC Name | N,N-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)carbamothioyl chloride |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCN(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=S)Cl |
| InChI | InChI=1S/C19H12ClF26NS/c20-7(48)47(5-1-3-8(21,22)10(25,26)12(29,30)14(33,34)16(37,38)18(41,42)43)6-2-4-9(23,24)11(27,28)13(31,32)15(35,36)17(39,40)19(44,45)46/h1-6H2 |
| InChIKey | MJFWKMJVEBOGRL-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.78 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|