C20H16F26S — CID 56590157
6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)undecane-1-thiol (PubChem CID 56590157) has the molecular formula C20H16F26S and a molecular weight of 782.36 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)undecane-1-thiol.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)undecane-1-thiol |
|---|---|
| PubChem CID | 56590157 |
| Molecular Formula | C20H16F26S |
| Molecular Weight | 782.36 g/mol |
| Exact Mass | 782.06 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)undecane-1-thiol |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCC(CS)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H16F26S/c21-9(22,11(25,26)13(29,30)15(33,34)17(37,38)19(41,42)43)5-1-3-8(7-47)4-2-6-10(23,24)12(27,28)14(31,32)16(35,36)18(39,40)20(44,45)46/h8,47H,1-7H2 |
| InChIKey | VSPAXWNCODBTBO-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.36 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|