C15H25F9O3P+ — CID 132572424
tris(3-hydroxypropyl)-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)phosphanium (PubChem CID 132572424) has the molecular formula C15H25F9O3P+ and a molecular weight of 455.32 g/mol. Its IUPAC name is tris(3-hydroxypropyl)-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)phosphanium.
| Compound Name | tris(3-hydroxypropyl)-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)phosphanium |
|---|---|
| PubChem CID | 132572424 |
| Molecular Formula | C15H25F9O3P+ |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | tris(3-hydroxypropyl)-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)phosphanium |
| SMILES | OCCC[P+](CCCO)(CCCO)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H25F9O3P/c16-12(17,13(18,19)14(20,21)15(22,23)24)4-11-28(8-1-5-25,9-2-6-26)10-3-7-27/h25-27H,1-11H2/q+1 |
| InChIKey | STVGHDODYWEMFC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|