C13H15F13O2 — CID 162348481
8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridecane-1,6-diol (PubChem CID 162348481) has the molecular formula C13H15F13O2 and a molecular weight of 450.24 g/mol. Its IUPAC name is 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridecane-1,6-diol.
| Compound Name | 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridecane-1,6-diol |
|---|---|
| PubChem CID | 162348481 |
| Molecular Formula | C13H15F13O2 |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 8,8,9,9,10,10,11,11,12,12,13,13,13-tridecafluorotridecane-1,6-diol |
| SMILES | OCCCCCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H15F13O2/c14-8(15,6-7(28)4-2-1-3-5-27)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h7,27-28H,1-6H2 |
| InChIKey | PTZSLYGITFOWAS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|