C10H15F7O2 — CID 137374790
8,8,9,9,10,10,10-heptafluorodecane-1,6-diol (PubChem CID 137374790) has the molecular formula C10H15F7O2 and a molecular weight of 300.21 g/mol. Its IUPAC name is 8,8,9,9,10,10,10-heptafluorodecane-1,6-diol.
| Compound Name | 8,8,9,9,10,10,10-heptafluorodecane-1,6-diol |
|---|---|
| PubChem CID | 137374790 |
| Molecular Formula | C10H15F7O2 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 8,8,9,9,10,10,10-heptafluorodecane-1,6-diol |
| SMILES | OCCCCCC(O)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H15F7O2/c11-8(12,9(13,14)10(15,16)17)6-7(19)4-2-1-3-5-18/h7,18-19H,1-6H2 |
| InChIKey | RTYCCOYYDBHIAG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|