C11H16F7IO — CID 152550034
9,9,10,10,11,11,11-heptafluoro-7-iodoundecan-1-ol (PubChem CID 152550034) has the molecular formula C11H16F7IO and a molecular weight of 424.14 g/mol. Its IUPAC name is 9,9,10,10,11,11,11-heptafluoro-7-iodoundecan-1-ol.
| Compound Name | 9,9,10,10,11,11,11-heptafluoro-7-iodoundecan-1-ol |
|---|---|
| PubChem CID | 152550034 |
| Molecular Formula | C11H16F7IO |
| Molecular Weight | 424.14 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 9,9,10,10,11,11,11-heptafluoro-7-iodoundecan-1-ol |
| SMILES | OCCCCCCC(I)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F7IO/c12-9(13,10(14,15)11(16,17)18)7-8(19)5-3-1-2-4-6-20/h8,20H,1-7H2 |
| InChIKey | YNHHEGHCQBAKKM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.14 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|