C14H16F13IO2 — CID 10257824
9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-7-iodotetradecane-1,2-diol (PubChem CID 10257824) has the molecular formula C14H16F13IO2 and a molecular weight of 590.16 g/mol. Its IUPAC name is 9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-7-iodotetradecane-1,2-diol.
| Compound Name | 9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-7-iodotetradecane-1,2-diol |
|---|---|
| PubChem CID | 10257824 |
| Molecular Formula | C14H16F13IO2 |
| Molecular Weight | 590.16 g/mol |
| Exact Mass | 590.00 |
| IUPAC Name | 9,9,10,10,11,11,12,12,13,13,14,14,14-tridecafluoro-7-iodotetradecane-1,2-diol |
| SMILES | OCC(O)CCCCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F13IO2/c15-9(16,5-7(28)3-1-2-4-8(30)6-29)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h7-8,29-30H,1-6H2 |
| InChIKey | PEHGRMWETVJAQD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.16 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|