C13H8F18I2 — CID 138396289
1,1,1,2,2,3,3,4,4,10,10,11,11,12,12,13,13,13-octadecafluoro-6,8-diiodotridecane (PubChem CID 138396289) has the molecular formula C13H8F18I2 and a molecular weight of 759.98 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,10,10,11,11,12,12,13,13,13-octadecafluoro-6,8-diiodotridecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,10,10,11,11,12,12,13,13,13-octadecafluoro-6,8-diiodotridecane |
|---|---|
| PubChem CID | 138396289 |
| Molecular Formula | C13H8F18I2 |
| Molecular Weight | 759.98 g/mol |
| Exact Mass | 759.84 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,10,10,11,11,12,12,13,13,13-octadecafluoro-6,8-diiodotridecane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(I)CC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F18I2/c14-6(15,8(18,19)10(22,23)12(26,27)28)2-4(32)1-5(33)3-7(16,17)9(20,21)11(24,25)13(29,30)31/h4-5H,1-3H2 |
| InChIKey | CUJYVGKVAYEFKL-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.98 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|