C9H6F13I — CID 97290812
(8R)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodononane (PubChem CID 97290812) has the molecular formula C9H6F13I and a molecular weight of 488.03 g/mol. Its IUPAC name is (8R)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodononane.
| Compound Name | (8R)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodononane |
|---|---|
| PubChem CID | 97290812 |
| Molecular Formula | C9H6F13I |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.93 |
| IUPAC Name | (8R)-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-8-iodononane |
| SMILES | C[C@@H](I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F13I/c1-3(23)2-4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h3H,2H2,1H3/t3-/m1/s1 |
| InChIKey | REPFTMOJFHVIBT-GSVOUGTGSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|