C5H6F5I — CID 97109313
(4R)-1,1,1,2,2-pentafluoro-4-iodopentane (PubChem CID 97109313) has the molecular formula C5H6F5I and a molecular weight of 288.00 g/mol. Its IUPAC name is (4R)-1,1,1,2,2-pentafluoro-4-iodopentane.
| Compound Name | (4R)-1,1,1,2,2-pentafluoro-4-iodopentane |
|---|---|
| PubChem CID | 97109313 |
| Molecular Formula | C5H6F5I |
| Molecular Weight | 288.00 g/mol |
| Exact Mass | 287.94 |
| IUPAC Name | (4R)-1,1,1,2,2-pentafluoro-4-iodopentane |
| SMILES | C[C@@H](I)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H6F5I/c1-3(11)2-4(6,7)5(8,9)10/h3H,2H2,1H3/t3-/m1/s1 |
| InChIKey | YRDACZYAYFEFJX-GSVOUGTGSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.00 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|