C6H6F8 — CID 87176653
1,1,1,2,2,5,5,5-octafluoro-4-methylpentane (PubChem CID 87176653) has the molecular formula C6H6F8 and a molecular weight of 230.10 g/mol. Its IUPAC name is 1,1,1,2,2,5,5,5-octafluoro-4-methylpentane.
| Compound Name | 1,1,1,2,2,5,5,5-octafluoro-4-methylpentane |
|---|---|
| PubChem CID | 87176653 |
| Molecular Formula | C6H6F8 |
| Molecular Weight | 230.10 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1,1,1,2,2,5,5,5-octafluoro-4-methylpentane |
| SMILES | CC(CC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F8/c1-3(5(9,10)11)2-4(7,8)6(12,13)14/h3H,2H2,1H3 |
| InChIKey | CJUHDXIAZFEVML-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.10 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|