C11H22F6 — CID 161468876
methane;bis(1,1,1-trifluoro-2-methylbutane) (PubChem CID 161468876) has the molecular formula C11H22F6 and a molecular weight of 268.28 g/mol. Its IUPAC name is methane;bis(1,1,1-trifluoro-2-methylbutane).
| Compound Name | methane;bis(1,1,1-trifluoro-2-methylbutane) |
|---|---|
| PubChem CID | 161468876 |
| Molecular Formula | C11H22F6 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | methane;bis(1,1,1-trifluoro-2-methylbutane) |
| SMILES | C.CCC(C)C(F)(F)F.CCC(C)C(F)(F)F |
| InChI | InChI=1S/2C5H9F3.CH4/c2*1-3-4(2)5(6,7)8;/h2*4H,3H2,1-2H3;1H4 |
| InChIKey | WCUNUXJEXCBEBQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |