C13H20F12 — CID 159118137
1,1,1,5,5,5-hexafluoro-2-methylpentane;methane;1,1,1-trifluoro-3-(trifluoromethyl)pentane (PubChem CID 159118137) has the molecular formula C13H20F12 and a molecular weight of 404.28 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-2-methylpentane;methane;1,1,1-trifluoro-3-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,5,5,5-hexafluoro-2-methylpentane;methane;1,1,1-trifluoro-3-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 159118137 |
| Molecular Formula | C13H20F12 |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-2-methylpentane;methane;1,1,1-trifluoro-3-(trifluoromethyl)pentane |
| SMILES | C.CC(CCC(F)(F)F)C(F)(F)F.CCC(CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/2C6H8F6.CH4/c1-4(6(10,11)12)2-3-5(7,8)9;1-2-4(6(10,11)12)3-5(7,8)9;/h2*4H,2-3H2,1H3;1H4 |
| InChIKey | KFIOGTRQMHZYLO-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |