C6H8F6 — CID 170263516
(3R)-1,1,1-trifluoro-3-(trifluoromethyl)pentane (PubChem CID 170263516) has the molecular formula C6H8F6 and a molecular weight of 194.12 g/mol. Its IUPAC name is (3R)-1,1,1-trifluoro-3-(trifluoromethyl)pentane.
| Compound Name | (3R)-1,1,1-trifluoro-3-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 170263516 |
| Molecular Formula | C6H8F6 |
| Molecular Weight | 194.12 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | (3R)-1,1,1-trifluoro-3-(trifluoromethyl)pentane |
| SMILES | CC[C@H](CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H8F6/c1-2-4(6(10,11)12)3-5(7,8)9/h4H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | BJHCHGKVUFFIRM-SCSAIBSYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.12 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |