C11H11F13 — CID 143403547
1,1,1,2-tetrafluoro-2,4,6-tris(trifluoromethyl)octane (PubChem CID 143403547) has the molecular formula C11H11F13 and a molecular weight of 390.18 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-2,4,6-tris(trifluoromethyl)octane.
| Compound Name | 1,1,1,2-tetrafluoro-2,4,6-tris(trifluoromethyl)octane |
|---|---|
| PubChem CID | 143403547 |
| Molecular Formula | C11H11F13 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1,1,1,2-tetrafluoro-2,4,6-tris(trifluoromethyl)octane |
| SMILES | CCC(CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H11F13/c1-2-5(8(13,14)15)3-6(9(16,17)18)4-7(12,10(19,20)21)11(22,23)24/h5-6H,2-4H2,1H3 |
| InChIKey | ARNKCUZDSUNVJA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |