C17H25ClF13NOS — CID 162320824
[2-hydroxy-3-[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl]sulfanylpropyl]-trimethylazanium chloride (PubChem CID 162320824) has the molecular formula C17H25ClF13NOS and a molecular weight of 573.89 g/mol. Its IUPAC name is [2-hydroxy-3-[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl]sulfanylpropyl]-trimethylazanium chloride.
| Compound Name | [2-hydroxy-3-[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl]sulfanylpropyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 162320824 |
| Molecular Formula | C17H25ClF13NOS |
| Molecular Weight | 573.89 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | [2-hydroxy-3-[7,8,8,8-tetrafluoro-3,5,7-tris(trifluoromethyl)octyl]sulfanylpropyl]-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CC(O)CSCCC(CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C17H25F13NOS.ClH/c1-31(2,3)8-12(32)9-33-5-4-10(14(19,20)21)6-11(15(22,23)24)7-13(18,16(25,26)27)17(28,29)30;/h10-12,32H,4-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ILTDXAAKBWVLKF-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.89 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|