C18H18F20S — CID 59721655
9,9,11,11,13,14,14,14-octafluoro-3,5,7,13-tetrakis(trifluoromethyl)tetradecane-1-thiol (PubChem CID 59721655) has the molecular formula C18H18F20S and a molecular weight of 646.37 g/mol. Its IUPAC name is 9,9,11,11,13,14,14,14-octafluoro-3,5,7,13-tetrakis(trifluoromethyl)tetradecane-1-thiol.
| Compound Name | 9,9,11,11,13,14,14,14-octafluoro-3,5,7,13-tetrakis(trifluoromethyl)tetradecane-1-thiol |
|---|---|
| PubChem CID | 59721655 |
| Molecular Formula | C18H18F20S |
| Molecular Weight | 646.37 g/mol |
| Exact Mass | 646.08 |
| IUPAC Name | 9,9,11,11,13,14,14,14-octafluoro-3,5,7,13-tetrakis(trifluoromethyl)tetradecane-1-thiol |
| SMILES | FC(F)(CC(CC(CC(CCS)C(F)(F)F)C(F)(F)F)C(F)(F)F)CC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H18F20S/c19-11(20,6-12(21,22)7-13(23,17(33,34)35)18(36,37)38)5-10(16(30,31)32)4-9(15(27,28)29)3-8(1-2-39)14(24,25)26/h8-10,39H,1-7H2 |
| InChIKey | RBWOEZFPWFBIPG-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.37 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|