C25H36F17N2O4S+ — CID 58419012
carboxymethyl-dimethyl-[3-[[9,9,11,11,13,14,14,14-octafluoro-13-methyl-3,5,7-tris(trifluoromethyl)tetradecyl]sulfonylamino]propyl]azanium (PubChem CID 58419012) has the molecular formula C25H36F17N2O4S+ and a molecular weight of 783.61 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-[[9,9,11,11,13,14,14,14-octafluoro-13-methyl-3,5,7-tris(trifluoromethyl)tetradecyl]sulfonylamino]propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-[[9,9,11,11,13,14,14,14-octafluoro-13-methyl-3,5,7-tris(trifluoromethyl)tetradecyl]sulfonylamino]propyl]azanium |
|---|---|
| PubChem CID | 58419012 |
| Molecular Formula | C25H36F17N2O4S+ |
| Molecular Weight | 783.61 g/mol |
| Exact Mass | 783.21 |
| IUPAC Name | carboxymethyl-dimethyl-[3-[[9,9,11,11,13,14,14,14-octafluoro-13-methyl-3,5,7-tris(trifluoromethyl)tetradecyl]sulfonylamino]propyl]azanium |
| SMILES | CC(F)(CC(F)(F)CC(F)(F)CC(CC(CC(CCS(=O)(=O)NCCC[N+](C)(C)CC(=O)O)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H35F17N2O4S/c1-19(26,25(40,41)42)13-21(29,30)14-20(27,28)11-17(24(37,38)39)10-16(23(34,35)36)9-15(22(31,32)33)5-8-49(47,48)43-6-4-7-44(2,3)12-18(45)46/h15-17,43H,4-14H2,1-3H3/p+1 |
| InChIKey | ITVCTFKCDDNBEQ-UHFFFAOYSA-O |
| XLogP | 7.89 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.61 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|