C17H29F7N2O4S — CID 58419097
2-[dimethyl-[3-[[7,8,8,8-tetrafluoro-7-methyl-5-(trifluoromethyl)octyl]sulfonylamino]propyl]azaniumyl]acetate (PubChem CID 58419097) has the molecular formula C17H29F7N2O4S and a molecular weight of 490.48 g/mol. Its IUPAC name is 2-[dimethyl-[3-[[7,8,8,8-tetrafluoro-7-methyl-5-(trifluoromethyl)octyl]sulfonylamino]propyl]azaniumyl]acetate.
| Compound Name | 2-[dimethyl-[3-[[7,8,8,8-tetrafluoro-7-methyl-5-(trifluoromethyl)octyl]sulfonylamino]propyl]azaniumyl]acetate |
|---|---|
| PubChem CID | 58419097 |
| Molecular Formula | C17H29F7N2O4S |
| Molecular Weight | 490.48 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2-[dimethyl-[3-[[7,8,8,8-tetrafluoro-7-methyl-5-(trifluoromethyl)octyl]sulfonylamino]propyl]azaniumyl]acetate |
| SMILES | CC(F)(CC(CCCCS(=O)(=O)NCCC[N+](C)(C)CC(=O)[O-])C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H29F7N2O4S/c1-15(18,17(22,23)24)11-13(16(19,20)21)7-4-5-10-31(29,30)25-8-6-9-26(2,3)12-14(27)28/h13,25H,4-12H2,1-3H3 |
| InChIKey | LEVUVGIPIYFOAP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|