C11H19F7N2O3S — CID 58901153
N,N-dimethyl-3-[[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylamino]propan-1-amine oxide (PubChem CID 58901153) has the molecular formula C11H19F7N2O3S and a molecular weight of 392.34 g/mol. Its IUPAC name is N,N-dimethyl-3-[[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylamino]propan-1-amine oxide.
| Compound Name | N,N-dimethyl-3-[[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylamino]propan-1-amine oxide |
|---|---|
| PubChem CID | 58901153 |
| Molecular Formula | C11H19F7N2O3S |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N,N-dimethyl-3-[[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylamino]propan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCNS(=O)(=O)CCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H19F7N2O3S/c1-20(2,21)7-4-6-19-24(22,23)8-3-5-9(12,10(13,14)15)11(16,17)18/h19H,3-8H2,1-2H3 |
| InChIKey | DXKZDIXJOTXZRO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|