C8H14F5NO2S — CID 140997847
4,4,5,5,5-pentafluoro-N-propylpentane-1-sulfonamide (PubChem CID 140997847) has the molecular formula C8H14F5NO2S and a molecular weight of 283.26 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-N-propylpentane-1-sulfonamide.
| Compound Name | 4,4,5,5,5-pentafluoro-N-propylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 140997847 |
| Molecular Formula | C8H14F5NO2S |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-N-propylpentane-1-sulfonamide |
| SMILES | CCCNS(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H14F5NO2S/c1-2-5-14-17(15,16)6-3-4-7(9,10)8(11,12)13/h14H,2-6H2,1H3 |
| InChIKey | MXPACYOAAFSSFD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|