C9H15F7N2O3S — CID 88943864
4,5,5,5-tetrafluoro-N-[3-(hydroxyamino)propyl]-4-(trifluoromethyl)pentane-1-sulfonamide (PubChem CID 88943864) has the molecular formula C9H15F7N2O3S and a molecular weight of 364.28 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-N-[3-(hydroxyamino)propyl]-4-(trifluoromethyl)pentane-1-sulfonamide.
| Compound Name | 4,5,5,5-tetrafluoro-N-[3-(hydroxyamino)propyl]-4-(trifluoromethyl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 88943864 |
| Molecular Formula | C9H15F7N2O3S |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 4,5,5,5-tetrafluoro-N-[3-(hydroxyamino)propyl]-4-(trifluoromethyl)pentane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(C(F)(F)F)C(F)(F)F)NCCCNO |
| InChI | InChI=1S/C9H15F7N2O3S/c10-7(8(11,12)13,9(14,15)16)3-1-6-22(20,21)18-5-2-4-17-19/h17-19H,1-6H2 |
| InChIKey | BAQSDKGYSIOKEO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|