C13H22F7N2O4S+ — CID 58901169
carboxymethyl-dimethyl-[3-[[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylamino]propyl]azanium (PubChem CID 58901169) has the molecular formula C13H22F7N2O4S+ and a molecular weight of 435.38 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[3-[[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylamino]propyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[3-[[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylamino]propyl]azanium |
|---|---|
| PubChem CID | 58901169 |
| Molecular Formula | C13H22F7N2O4S+ |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | carboxymethyl-dimethyl-[3-[[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentyl]sulfonylamino]propyl]azanium |
| SMILES | C[N+](C)(CCCNS(=O)(=O)CCCC(F)(C(F)(F)F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C13H21F7N2O4S/c1-22(2,9-10(23)24)7-4-6-21-27(25,26)8-3-5-11(14,12(15,16)17)13(18,19)20/h21H,3-9H2,1-2H3/p+1 |
| InChIKey | GASGROTWKDRDAG-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|