C13H21F7NO4S+ — CID 123774725
carboxymethyl-dimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium (PubChem CID 123774725) has the molecular formula C13H21F7NO4S+ and a molecular weight of 420.37 g/mol. Its IUPAC name is carboxymethyl-dimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium.
| Compound Name | carboxymethyl-dimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium |
|---|---|
| PubChem CID | 123774725 |
| Molecular Formula | C13H21F7NO4S+ |
| Molecular Weight | 420.37 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | carboxymethyl-dimethyl-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutyl]azanium |
| SMILES | C[N+](C)(CCCCS(=O)(=O)CCC(F)(C(F)(F)F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C13H20F7NO4S/c1-21(2,9-10(22)23)6-3-4-7-26(24,25)8-5-11(14,12(15,16)17)13(18,19)20/h3-9H2,1-2H3/p+1 |
| InChIKey | FRKAWJQPOFDNDH-UHFFFAOYSA-O |
| XLogP | 2.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|