C11H18F7NO3S — CID 86696852
2-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutylamino]ethanol (PubChem CID 86696852) has the molecular formula C11H18F7NO3S and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutylamino]ethanol.
| Compound Name | 2-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutylamino]ethanol |
|---|---|
| PubChem CID | 86696852 |
| Molecular Formula | C11H18F7NO3S |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[4-[3,4,4,4-tetrafluoro-3-(trifluoromethyl)butyl]sulfonylbutylamino]ethanol |
| SMILES | O=S(=O)(CCCCNCCO)CCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H18F7NO3S/c12-9(10(13,14)15,11(16,17)18)3-8-23(21,22)7-2-1-4-19-5-6-20/h19-20H,1-8H2 |
| InChIKey | NKXODYSEHKTYMS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|